C22H23ClN5O+ — CID 135571893
(Z,4S)-2-(1H-benzimidazol-2-yl)-4-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-hydroxypent-2-enenitrile (PubChem CID 135571893) has the molecular formula C22H23ClN5O+ and a molecular weight of 408.91 g/mol. Its IUPAC name is (Z,4S)-2-(1H-benzimidazol-2-yl)-4-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-hydroxypent-2-enenitrile.
| Compound Name | (Z,4S)-2-(1H-benzimidazol-2-yl)-4-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 135571893 |
| Molecular Formula | C22H23ClN5O+ |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (Z,4S)-2-(1H-benzimidazol-2-yl)-4-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-3-hydroxypent-2-enenitrile |
| SMILES | C[C@@H](/C(O)=C(\C#N)c1nc2ccccc2[nH]1)[NH+]1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H22ClN5O/c1-15(27-9-11-28(12-10-27)17-6-4-5-16(23)13-17)21(29)18(14-24)22-25-19-7-2-3-8-20(19)26-22/h2-8,13,15,29H,9-12H2,1H3,(H,25,26)/p+1/b21-18-/t15-/m0/s1 |
| InChIKey | SVPKTOWCVRTCDG-BAOKRACBSA-O |
| XLogP | 2.80 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|