C22H20F3N5O — CID 135587922
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enenitrile (PubChem CID 135587922) has the molecular formula C22H20F3N5O and a molecular weight of 427.43 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 135587922 |
| Molecular Formula | C22H20F3N5O |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]but-2-enenitrile |
| SMILES | N#C/C(=C(/O)CN1CCN(c2cccc(C(F)(F)F)c2)CC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H20F3N5O/c23-22(24,25)15-4-3-5-16(12-15)30-10-8-29(9-11-30)14-20(31)17(13-26)21-27-18-6-1-2-7-19(18)28-21/h1-7,12,31H,8-11,14H2,(H,27,28)/b20-17- |
| InChIKey | JVOKDNASVAOSHW-JZJYNLBNSA-N |
| XLogP | 4.20 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|