C25H27N5O3S — CID 135932925
2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]but-2-enenitrile (PubChem CID 135932925) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]but-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 135932925 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-yl]but-2-enenitrile |
| SMILES | N#CC(=C(O)CN1CCN(S(=O)(=O)c2ccc3c(c2)CCCC3)CC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H27N5O3S/c26-16-21(25-27-22-7-3-4-8-23(22)28-25)24(31)17-29-11-13-30(14-12-29)34(32,33)20-10-9-18-5-1-2-6-19(18)15-20/h3-4,7-10,15,31H,1-2,5-6,11-14,17H2,(H,27,28) |
| InChIKey | NJKMJLNPCOJQBT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|