C21H20N4O — CID 135761746
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)but-2-enenitrile (PubChem CID 135761746) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)but-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)but-2-enenitrile |
|---|---|
| PubChem CID | 135761746 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)but-2-enenitrile |
| SMILES | Cc1ccc2c(c1)CCCN2C/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H20N4O/c1-14-8-9-19-15(11-14)5-4-10-25(19)13-20(26)16(12-22)21-23-17-6-2-3-7-18(17)24-21/h2-3,6-9,11,26H,4-5,10,13H2,1H3,(H,23,24)/b20-16- |
| InChIKey | MEYHIFIEVJGGHK-SILNSSARSA-N |
| XLogP | 4.12 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|