C24H28N5O2+ — CID 135571567
(Z,4R)-2-(1H-benzimidazol-2-yl)-4-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-3-hydroxypent-2-enenitrile (PubChem CID 135571567) has the molecular formula C24H28N5O2+ and a molecular weight of 418.52 g/mol. Its IUPAC name is (Z,4R)-2-(1H-benzimidazol-2-yl)-4-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-3-hydroxypent-2-enenitrile.
| Compound Name | (Z,4R)-2-(1H-benzimidazol-2-yl)-4-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 135571567 |
| Molecular Formula | C24H28N5O2+ |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (Z,4R)-2-(1H-benzimidazol-2-yl)-4-[4-(2-ethoxyphenyl)piperazin-1-ium-1-yl]-3-hydroxypent-2-enenitrile |
| SMILES | CCOc1ccccc1N1CC[NH+]([C@H](C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C24H27N5O2/c1-3-31-22-11-7-6-10-21(22)29-14-12-28(13-15-29)17(2)23(30)18(16-25)24-26-19-8-4-5-9-20(19)27-24/h4-11,17,30H,3,12-15H2,1-2H3,(H,26,27)/p+1/b23-18-/t17-/m1/s1 |
| InChIKey | QNLLXBQXSRENCX-USMQXWLVSA-O |
| XLogP | 2.55 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|