C18H22N4O — CID 135556541
(Z,4R)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(4-methylpiperidin-1-yl)pent-2-enenitrile (PubChem CID 135556541) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is (Z,4R)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(4-methylpiperidin-1-yl)pent-2-enenitrile.
| Compound Name | (Z,4R)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(4-methylpiperidin-1-yl)pent-2-enenitrile |
|---|---|
| PubChem CID | 135556541 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (Z,4R)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-(4-methylpiperidin-1-yl)pent-2-enenitrile |
| SMILES | CC1CCN([C@H](C)/C(O)=C(\C#N)c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C18H22N4O/c1-12-7-9-22(10-8-12)13(2)17(23)14(11-19)18-20-15-5-3-4-6-16(15)21-18/h3-6,12-13,23H,7-10H2,1-2H3,(H,20,21)/b17-14-/t13-/m1/s1 |
| InChIKey | AGWXURWPBOYPFK-CLBVAXQTSA-N |
| XLogP | 3.48 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|