C21H16N4O4 — CID 135718143
[(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(1,2-benzoxazol-3-yl)acetate (PubChem CID 135718143) has the molecular formula C21H16N4O4 and a molecular weight of 388.38 g/mol. Its IUPAC name is [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(1,2-benzoxazol-3-yl)acetate.
| Compound Name | [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(1,2-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 135718143 |
| Molecular Formula | C21H16N4O4 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [(Z,2S)-4-(1H-benzimidazol-2-yl)-4-cyano-3-hydroxybut-3-en-2-yl] 2-(1,2-benzoxazol-3-yl)acetate |
| SMILES | C[C@H](OC(=O)Cc1noc2ccccc12)/C(O)=C(\C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H16N4O4/c1-12(28-19(26)10-17-13-6-2-5-9-18(13)29-25-17)20(27)14(11-22)21-23-15-7-3-4-8-16(15)24-21/h2-9,12,27H,10H2,1H3,(H,23,24)/b20-14-/t12-/m0/s1 |
| InChIKey | BIIYLDHMZIWVEH-SXPRPLFSSA-N |
| XLogP | 3.67 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|