C22H19ClN4O6S — CID 135466286
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 135466286) has the molecular formula C22H19ClN4O6S and a molecular weight of 502.94 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 135466286 |
| Molecular Formula | C22H19ClN4O6S |
| Molecular Weight | 502.94 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | N#C/C(=C(/O)COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H19ClN4O6S/c23-16-6-5-14(11-20(16)34(30,31)27-7-9-32-10-8-27)22(29)33-13-19(28)15(12-24)21-25-17-3-1-2-4-18(17)26-21/h1-6,11,28H,7-10,13H2,(H,25,26)/b19-15- |
| InChIKey | MEDIYMHXJNNJDR-CYVLTUHYSA-N |
| XLogP | 2.89 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.94 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|