C16H15N3O4 — CID 2121271
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-oxolane-2-carboxylate (PubChem CID 2121271) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-oxolane-2-carboxylate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 2121271 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (2S)-oxolane-2-carboxylate |
| SMILES | N#CC(=C(O)COC(=O)[C@@H]1CCCO1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H15N3O4/c17-8-10(15-18-11-4-1-2-5-12(11)19-15)13(20)9-23-16(21)14-6-3-7-22-14/h1-2,4-5,14,20H,3,6-7,9H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | UJTHSQZALZCTSZ-AWEZNQCLSA-N |
| XLogP | 2.08 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|