C20H18N4O4S — CID 3905005
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate (PubChem CID 3905005) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3905005 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CC(=O)Nc1sc(C)c(C)c1C(=O)OCC(O)=C(C#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H18N4O4S/c1-10-11(2)29-19(22-12(3)25)17(10)20(27)28-9-16(26)13(8-21)18-23-14-6-4-5-7-15(14)24-18/h4-7,26H,9H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | WGOLJWLFZQOWSY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|