C24H25N3O4 — CID 2496587
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate (PubChem CID 2496587) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2496587 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccccc2)nc2ccccc2c1C(=O)OCC(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C24H25N3O4/c1-15-20(22(29)31-14-19(28)26-23(30)27-24(2,3)4)17-12-8-9-13-18(17)25-21(15)16-10-6-5-7-11-16/h5-13H,14H2,1-4H3,(H2,26,27,28,30) |
| InChIKey | HHTGRONFTVTCHF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |