C34H26N2O3 — CID 2401989
[2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate (PubChem CID 2401989) has the molecular formula C34H26N2O3 and a molecular weight of 510.59 g/mol. Its IUPAC name is [2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate.
| Compound Name | [2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2401989 |
| Molecular Formula | C34H26N2O3 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | [2-(1-methyl-2-phenylindol-3-yl)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccccc2)nc2ccccc2c1C(=O)OCC(=O)c1c(-c2ccccc2)n(C)c2ccccc12 |
| InChI | InChI=1S/C34H26N2O3/c1-22-30(25-17-9-11-19-27(25)35-32(22)23-13-5-3-6-14-23)34(38)39-21-29(37)31-26-18-10-12-20-28(26)36(2)33(31)24-15-7-4-8-16-24/h3-20H,21H2,1-2H3 |
| InChIKey | VRGWMGJDEKCOAJ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |