C17H15BrN2O5 — CID 7971766
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate (PubChem CID 7971766) has the molecular formula C17H15BrN2O5 and a molecular weight of 407.22 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7971766 |
| Molecular Formula | C17H15BrN2O5 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(Br)cc1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H15BrN2O5/c18-13-6-3-12(4-7-13)5-8-16(22)25-11-15(21)20-17(23)19-10-14-2-1-9-24-14/h1-9H,10-11H2,(H2,19,20,21,23)/b8-5+ |
| InChIKey | OHPVVAKHZLVFCQ-VMPITWQZSA-N |
| XLogP | 2.62 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|