C16H14BrNO4 — CID 7882158
[2-(furan-2-ylmethylamino)-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate (PubChem CID 7882158) has the molecular formula C16H14BrNO4 and a molecular weight of 364.20 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7882158 |
| Molecular Formula | C16H14BrNO4 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccccc1Br)NCc1ccco1 |
| InChI | InChI=1S/C16H14BrNO4/c17-14-6-2-1-4-12(14)7-8-16(20)22-11-15(19)18-10-13-5-3-9-21-13/h1-9H,10-11H2,(H,18,19)/b8-7+ |
| InChIKey | QRMLVNYDIJKEFV-BQYQJAHWSA-N |
| XLogP | 2.91 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|