C15H18BrNO3 — CID 7881949
[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate (PubChem CID 7881949) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate.
| Compound Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7881949 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] (E)-3-(2-bromophenyl)prop-2-enoate |
| SMILES | CC[C@@H](C)NC(=O)COC(=O)/C=C/c1ccccc1Br |
| InChI | InChI=1S/C15H18BrNO3/c1-3-11(2)17-14(18)10-20-15(19)9-8-12-6-4-5-7-13(12)16/h4-9,11H,3,10H2,1-2H3,(H,17,18)/b9-8+/t11-/m1/s1 |
| InChIKey | NCARESSFJJVHNW-ANYFNZRUSA-N |
| XLogP | 2.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|