C21H27NO2 — CID 21019854
2-[[3-(4-tert-butylphenyl)-3-phenylpropyl]amino]acetic acid (PubChem CID 21019854) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-[[3-(4-tert-butylphenyl)-3-phenylpropyl]amino]acetic acid.
| Compound Name | 2-[[3-(4-tert-butylphenyl)-3-phenylpropyl]amino]acetic acid |
|---|---|
| PubChem CID | 21019854 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-[[3-(4-tert-butylphenyl)-3-phenylpropyl]amino]acetic acid |
| SMILES | CC(C)(C)c1ccc(C(CCNCC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO2/c1-21(2,3)18-11-9-17(10-12-18)19(13-14-22-15-20(23)24)16-7-5-4-6-8-16/h4-12,19,22H,13-15H2,1-3H3,(H,23,24) |
| InChIKey | QAKMCNSSQXZXSV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|