C25H35NO2 — CID 89278572
2-amino-2-[2-[4-(8-phenyloct-1-en-2-yl)phenyl]ethyl]propane-1,3-diol (PubChem CID 89278572) has the molecular formula C25H35NO2 and a molecular weight of 381.56 g/mol. Its IUPAC name is 2-amino-2-[2-[4-(8-phenyloct-1-en-2-yl)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-(8-phenyloct-1-en-2-yl)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 89278572 |
| Molecular Formula | C25H35NO2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.27 |
| IUPAC Name | 2-amino-2-[2-[4-(8-phenyloct-1-en-2-yl)phenyl]ethyl]propane-1,3-diol |
| SMILES | C=C(CCCCCCc1ccccc1)c1ccc(CCC(N)(CO)CO)cc1 |
| InChI | InChI=1S/C25H35NO2/c1-21(9-5-2-3-6-10-22-11-7-4-8-12-22)24-15-13-23(14-16-24)17-18-25(26,19-27)20-28/h4,7-8,11-16,27-28H,1-3,5-6,9-10,17-20,26H2 |
| InChIKey | CNINGHLVSLDKLS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|