C26H37N — CID 67680855
4-[(Z)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-2-enyl]benzonitrile (PubChem CID 67680855) has the molecular formula C26H37N and a molecular weight of 363.59 g/mol. Its IUPAC name is 4-[(Z)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-2-enyl]benzonitrile.
| Compound Name | 4-[(Z)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-2-enyl]benzonitrile |
|---|---|
| PubChem CID | 67680855 |
| Molecular Formula | C26H37N |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | 4-[(Z)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-2-enyl]benzonitrile |
| SMILES | CCCC1CCC(C2CCC(C/C=C\Cc3ccc(C#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H37N/c1-2-5-21-12-16-25(17-13-21)26-18-14-23(15-19-26)7-4-3-6-22-8-10-24(20-27)11-9-22/h3-4,8-11,21,23,25-26H,2,5-7,12-19H2,1H3/b4-3- |
| InChIKey | XGCRIHJUJANZTF-ARJAWSKDSA-N |
| XLogP | 7.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|