C19H23F3O2 — CID 54325712
[4-[2-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl] but-2-enoate (PubChem CID 54325712) has the molecular formula C19H23F3O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is [4-[2-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl] but-2-enoate.
| Compound Name | [4-[2-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl] but-2-enoate |
|---|---|
| PubChem CID | 54325712 |
| Molecular Formula | C19H23F3O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | [4-[2-[4-(trifluoromethyl)phenyl]ethyl]cyclohexyl] but-2-enoate |
| SMILES | CC=CC(=O)OC1CCC(CCc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H23F3O2/c1-2-3-18(23)24-17-12-8-15(9-13-17)5-4-14-6-10-16(11-7-14)19(20,21)22/h2-3,6-7,10-11,15,17H,4-5,8-9,12-13H2,1H3 |
| InChIKey | SUTNQPCBBLOFGJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|