C19H30FN — CID 19695524
4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]cyclohexane-1-carbonitrile (PubChem CID 19695524) has the molecular formula C19H30FN and a molecular weight of 291.45 g/mol. Its IUPAC name is 4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 19695524 |
| Molecular Formula | C19H30FN |
| Molecular Weight | 291.45 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 4-[2-[4-[(E)-4-fluorobut-1-enyl]cyclohexyl]ethyl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(CCC2CCC(/C=C/CCF)CC2)CC1 |
| InChI | InChI=1S/C19H30FN/c20-14-2-1-3-16-4-6-17(7-5-16)8-9-18-10-12-19(15-21)13-11-18/h1,3,16-19H,2,4-14H2/b3-1+ |
| InChIKey | XJDWQUWHRIGQPS-HNQUOIGGSA-N |
| XLogP | 5.82 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|