C22H29F2Y+2 — CID 23574074
1-[4-[4-[(E)-but-2-enyl]cyclohexyl]cyclohexyl]-3,5-difluorobenzene-4-ide;yttrium(3+) (PubChem CID 23574074) has the molecular formula C22H29F2Y+2 and a molecular weight of 420.38 g/mol. Its IUPAC name is 1-[4-[4-[(E)-but-2-enyl]cyclohexyl]cyclohexyl]-3,5-difluorobenzene-4-ide;yttrium(3+).
| Compound Name | 1-[4-[4-[(E)-but-2-enyl]cyclohexyl]cyclohexyl]-3,5-difluorobenzene-4-ide;yttrium(3+) |
|---|---|
| PubChem CID | 23574074 |
| Molecular Formula | C22H29F2Y+2 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-[4-[4-[(E)-but-2-enyl]cyclohexyl]cyclohexyl]-3,5-difluorobenzene-4-ide;yttrium(3+) |
| SMILES | C/C=C/CC1CCC(C2CCC(c3cc(F)[c-]c(F)c3)CC2)CC1.[Y+3] |
| InChI | InChI=1S/C22H29F2.Y/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)20-13-21(23)15-22(24)14-20;/h2-3,13-14,16-19H,4-12H2,1H3;/q-1;+3/b3-2+; |
| InChIKey | GXYVTXICWPLWIF-SQQVDAMQSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|