C28H40F4O — CID 22446775
4-[4-[4-(2-cyclopentylbutyl)cyclohexyl]cyclohexyl]-2-fluoro-1-(trifluoromethoxy)benzene (PubChem CID 22446775) has the molecular formula C28H40F4O and a molecular weight of 468.62 g/mol. Its IUPAC name is 4-[4-[4-(2-cyclopentylbutyl)cyclohexyl]cyclohexyl]-2-fluoro-1-(trifluoromethoxy)benzene.
| Compound Name | 4-[4-[4-(2-cyclopentylbutyl)cyclohexyl]cyclohexyl]-2-fluoro-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 22446775 |
| Molecular Formula | C28H40F4O |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 4-[4-[4-(2-cyclopentylbutyl)cyclohexyl]cyclohexyl]-2-fluoro-1-(trifluoromethoxy)benzene |
| SMILES | CCC(CC1CCC(C2CCC(c3ccc(OC(F)(F)F)c(F)c3)CC2)CC1)C1CCCC1 |
| InChI | InChI=1S/C28H40F4O/c1-2-20(21-5-3-4-6-21)17-19-7-9-22(10-8-19)23-11-13-24(14-12-23)25-15-16-27(26(29)18-25)33-28(30,31)32/h15-16,18-24H,2-14,17H2,1H3 |
| InChIKey | KECJNUNQGPWIBH-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |