C21H33F3O3 — CID 161210259
1-[hydroperoxy-[4-(4-methylcyclohexyl)cyclohexyl]methyl]-4-(trifluoromethoxy)benzene;molecular hydrogen (PubChem CID 161210259) has the molecular formula C21H33F3O3 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-[hydroperoxy-[4-(4-methylcyclohexyl)cyclohexyl]methyl]-4-(trifluoromethoxy)benzene;molecular hydrogen.
| Compound Name | 1-[hydroperoxy-[4-(4-methylcyclohexyl)cyclohexyl]methyl]-4-(trifluoromethoxy)benzene;molecular hydrogen |
|---|---|
| PubChem CID | 161210259 |
| Molecular Formula | C21H33F3O3 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-[hydroperoxy-[4-(4-methylcyclohexyl)cyclohexyl]methyl]-4-(trifluoromethoxy)benzene;molecular hydrogen |
| SMILES | CC1CCC(C2CCC(C(OO)c3ccc(OC(F)(F)F)cc3)CC2)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C21H29F3O3.2H2/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)20(27-25)18-10-12-19(13-11-18)26-21(22,23)24;;/h10-17,20,25H,2-9H2,1H3;2*1H |
| InChIKey | UWDHGVDIAAWTRY-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|