C9H9BrF2N2O2 — CID 83135008
2-(4-bromo-3-methylphenoxy)-2,2-difluoroacetohydrazide (PubChem CID 83135008) has the molecular formula C9H9BrF2N2O2 and a molecular weight of 295.08 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenoxy)-2,2-difluoroacetohydrazide.
| Compound Name | 2-(4-bromo-3-methylphenoxy)-2,2-difluoroacetohydrazide |
|---|---|
| PubChem CID | 83135008 |
| Molecular Formula | C9H9BrF2N2O2 |
| Molecular Weight | 295.08 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 2-(4-bromo-3-methylphenoxy)-2,2-difluoroacetohydrazide |
| SMILES | Cc1cc(OC(F)(F)C(=O)NN)ccc1Br |
| InChI | InChI=1S/C9H9BrF2N2O2/c1-5-4-6(2-3-7(5)10)16-9(11,12)8(15)14-13/h2-4H,13H2,1H3,(H,14,15) |
| InChIKey | FGHSOJLPEBWMFT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.08 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|