C22H28OSi — CID 102148278
tert-butyl-[4-[2-(3,4-dimethylphenyl)ethynyl]phenoxy]-dimethylsilane (PubChem CID 102148278) has the molecular formula C22H28OSi and a molecular weight of 336.55 g/mol. Its IUPAC name is tert-butyl-[4-[2-(3,4-dimethylphenyl)ethynyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[2-(3,4-dimethylphenyl)ethynyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102148278 |
| Molecular Formula | C22H28OSi |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | tert-butyl-[4-[2-(3,4-dimethylphenyl)ethynyl]phenoxy]-dimethylsilane |
| SMILES | Cc1ccc(C#Cc2ccc(O[Si](C)(C)C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C22H28OSi/c1-17-8-9-20(16-18(17)2)11-10-19-12-14-21(15-13-19)23-24(6,7)22(3,4)5/h8-9,12-16H,1-7H3 |
| InChIKey | VSXROMSZMIUMBT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|