C27H28OSi — CID 101439155
tert-butyl-[4-[2-(9H-fluoren-2-yl)ethynyl]phenoxy]-dimethylsilane (PubChem CID 101439155) has the molecular formula C27H28OSi and a molecular weight of 396.61 g/mol. Its IUPAC name is tert-butyl-[4-[2-(9H-fluoren-2-yl)ethynyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[2-(9H-fluoren-2-yl)ethynyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101439155 |
| Molecular Formula | C27H28OSi |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | tert-butyl-[4-[2-(9H-fluoren-2-yl)ethynyl]phenoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C#Cc2ccc3c(c2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C27H28OSi/c1-27(2,3)29(4,5)28-24-15-12-20(13-16-24)10-11-21-14-17-26-23(18-21)19-22-8-6-7-9-25(22)26/h6-9,12-18H,19H2,1-5H3 |
| InChIKey | VUMRQCSVMMPYMZ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|