C31H34O8Si — CID 160528963
4-[[tert-butyl(dimethyl)silyl]oxymethyl]furan-2-carboxylic acid;4-(9H-fluoren-2-yloxymethyl)furan-2-carboxylic acid (PubChem CID 160528963) has the molecular formula C31H34O8Si and a molecular weight of 562.69 g/mol. Its IUPAC name is 4-[[tert-butyl(dimethyl)silyl]oxymethyl]furan-2-carboxylic acid;4-(9H-fluoren-2-yloxymethyl)furan-2-carboxylic acid.
| Compound Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]furan-2-carboxylic acid;4-(9H-fluoren-2-yloxymethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 160528963 |
| Molecular Formula | C31H34O8Si |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]furan-2-carboxylic acid;4-(9H-fluoren-2-yloxymethyl)furan-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCc1coc(C(=O)O)c1.O=C(O)c1cc(COc2ccc3c(c2)Cc2ccccc2-3)co1 |
| InChI | InChI=1S/C19H14O4.C12H20O4Si/c20-19(21)18-7-12(11-23-18)10-22-15-5-6-17-14(9-15)8-13-3-1-2-4-16(13)17;1-12(2,3)17(4,5)16-8-9-6-10(11(13)14)15-7-9/h1-7,9,11H,8,10H2,(H,20,21);6-7H,8H2,1-5H3,(H,13,14) |
| InChIKey | QVGWTVNFEZYVEV-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|