C15H23NOSi — CID 134847052
4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylbenzonitrile (PubChem CID 134847052) has the molecular formula C15H23NOSi and a molecular weight of 261.44 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylbenzonitrile.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylbenzonitrile |
|---|---|
| PubChem CID | 134847052 |
| Molecular Formula | C15H23NOSi |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylbenzonitrile |
| SMILES | Cc1cc(O[Si](C)(C)C(C)(C)C)cc(C)c1C#N |
| InChI | InChI=1S/C15H23NOSi/c1-11-8-13(9-12(2)14(11)10-16)17-18(6,7)15(3,4)5/h8-9H,1-7H3 |
| InChIKey | SOMSPQFVQWJZQW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|