C31H22O5 — CID 24747925
5-[2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)ethynyl]-1-benzofuran-5-yl]-1,3-benzodioxole (PubChem CID 24747925) has the molecular formula C31H22O5 and a molecular weight of 474.51 g/mol. Its IUPAC name is 5-[2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)ethynyl]-1-benzofuran-5-yl]-1,3-benzodioxole.
| Compound Name | 5-[2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)ethynyl]-1-benzofuran-5-yl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 24747925 |
| Molecular Formula | C31H22O5 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 5-[2-(4-methoxyphenyl)-3-[2-(4-methoxyphenyl)ethynyl]-1-benzofuran-5-yl]-1,3-benzodioxole |
| SMILES | COc1ccc(C#Cc2c(-c3ccc(OC)cc3)oc3ccc(-c4ccc5c(c4)OCO5)cc23)cc1 |
| InChI | InChI=1S/C31H22O5/c1-32-24-10-3-20(4-11-24)5-14-26-27-17-22(23-9-16-29-30(18-23)35-19-34-29)8-15-28(27)36-31(26)21-6-12-25(33-2)13-7-21/h3-4,6-13,15-18H,19H2,1-2H3 |
| InChIKey | ANZKJVMMGHISMC-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|