C32H32O6 — CID 122217288
1-[2-[2-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1-benzofuran-3-yl]ethynyl]cyclohexan-1-ol (PubChem CID 122217288) has the molecular formula C32H32O6 and a molecular weight of 512.60 g/mol. Its IUPAC name is 1-[2-[2-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1-benzofuran-3-yl]ethynyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[2-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1-benzofuran-3-yl]ethynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 122217288 |
| Molecular Formula | C32H32O6 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 1-[2-[2-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1-benzofuran-3-yl]ethynyl]cyclohexan-1-ol |
| SMILES | COc1ccc(-c2oc3ccc(-c4cc(OC)c(OC)c(OC)c4)cc3c2C#CC2(O)CCCCC2)cc1 |
| InChI | InChI=1S/C32H32O6/c1-34-24-11-8-21(9-12-24)30-25(14-17-32(33)15-6-5-7-16-32)26-18-22(10-13-27(26)38-30)23-19-28(35-2)31(37-4)29(20-23)36-3/h8-13,18-20,33H,5-7,15-16H2,1-4H3 |
| InChIKey | ANZZASVJBJKZNG-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|