C27H22O5 — CID 24747811
[3-(4-hydroxybut-1-ynyl)-2-(4-methoxyphenyl)-1-benzofuran-5-yl]-(4-methoxyphenyl)methanone (PubChem CID 24747811) has the molecular formula C27H22O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is [3-(4-hydroxybut-1-ynyl)-2-(4-methoxyphenyl)-1-benzofuran-5-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [3-(4-hydroxybut-1-ynyl)-2-(4-methoxyphenyl)-1-benzofuran-5-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 24747811 |
| Molecular Formula | C27H22O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [3-(4-hydroxybut-1-ynyl)-2-(4-methoxyphenyl)-1-benzofuran-5-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccc3oc(-c4ccc(OC)cc4)c(C#CCCO)c3c2)cc1 |
| InChI | InChI=1S/C27H22O5/c1-30-21-11-6-18(7-12-21)26(29)20-10-15-25-24(17-20)23(5-3-4-16-28)27(32-25)19-8-13-22(31-2)14-9-19/h6-15,17,28H,4,16H2,1-2H3 |
| InChIKey | PXALMCMXZHCCMU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|