C11H16O2Si — CID 130535838
2,3-dihydro-1,4-benzodioxin-6-yl(trimethyl)silane (PubChem CID 130535838) has the molecular formula C11H16O2Si and a molecular weight of 208.33 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl(trimethyl)silane.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl(trimethyl)silane |
|---|---|
| PubChem CID | 130535838 |
| Molecular Formula | C11H16O2Si |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl(trimethyl)silane |
| SMILES | C[Si](C)(C)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H16O2Si/c1-14(2,3)9-4-5-10-11(8-9)13-7-6-12-10/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | XIHKRVGLNCANGP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|