C40H42N2O14 — CID 102302866
3-O-[[24-[[3-oxo-3-(pyridin-4-ylmethoxy)propanoyl]oxymethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl] 1-O-(pyridin-4-ylmethyl) propanedioate (PubChem CID 102302866) has the molecular formula C40H42N2O14 and a molecular weight of 774.78 g/mol. Its IUPAC name is 3-O-[[24-[[3-oxo-3-(pyridin-4-ylmethoxy)propanoyl]oxymethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl] 1-O-(pyridin-4-ylmethyl) propanedioate.
| Compound Name | 3-O-[[24-[[3-oxo-3-(pyridin-4-ylmethoxy)propanoyl]oxymethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl] 1-O-(pyridin-4-ylmethyl) propanedioate |
|---|---|
| PubChem CID | 102302866 |
| Molecular Formula | C40H42N2O14 |
| Molecular Weight | 774.78 g/mol |
| Exact Mass | 774.26 |
| IUPAC Name | 3-O-[[24-[[3-oxo-3-(pyridin-4-ylmethoxy)propanoyl]oxymethyl]-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaen-11-yl]methyl] 1-O-(pyridin-4-ylmethyl) propanedioate |
| SMILES | O=C(CC(=O)OCc1ccc2c(c1)OCCOCCOc1ccc(COC(=O)CC(=O)OCc3ccncc3)cc1OCCOCCO2)OCc1ccncc1 |
| InChI | InChI=1S/C40H42N2O14/c43-37(53-25-29-5-9-41-10-6-29)23-39(45)55-27-31-1-3-33-35(21-31)51-19-15-48-14-18-50-34-4-2-32(22-36(34)52-20-16-47-13-17-49-33)28-56-40(46)24-38(44)54-26-30-7-11-42-12-8-30/h1-12,21-22H,13-20,23-28H2 |
| InChIKey | FJQCEZDHQMSSPT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 186.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|