C43H51NO13 — CID 163712092
2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-ylmethyl 4-(2-nitro-1,1-diphenylethoxy)butanoate (PubChem CID 163712092) has the molecular formula C43H51NO13 and a molecular weight of 789.87 g/mol. Its IUPAC name is 2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-ylmethyl 4-(2-nitro-1,1-diphenylethoxy)butanoate.
| Compound Name | 2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-ylmethyl 4-(2-nitro-1,1-diphenylethoxy)butanoate |
|---|---|
| PubChem CID | 163712092 |
| Molecular Formula | C43H51NO13 |
| Molecular Weight | 789.87 g/mol |
| Exact Mass | 789.34 |
| IUPAC Name | 2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12(17),13,15,28,30-hexaen-14-ylmethyl 4-(2-nitro-1,1-diphenylethoxy)butanoate |
| SMILES | O=C(CCCOC(C[N+](=O)[O-])(c1ccccc1)c1ccccc1)OCc1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C43H51NO13/c45-42(16-9-19-57-43(34-44(46)47,36-10-3-1-4-11-36)37-12-5-2-6-13-37)56-33-35-17-18-40-41(32-35)55-31-27-51-23-22-49-25-29-53-39-15-8-7-14-38(39)52-28-24-48-20-21-50-26-30-54-40/h1-8,10-15,17-18,32H,9,16,19-31,33-34H2 |
| InChIKey | UOXAVLQCZZEOTN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 152.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.87 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|