C88H66O12 — CID 101399905
[3,5-bis[[3,5-bis[(4-benzoylphenyl)methoxy]phenyl]methoxy]phenyl]methyl naphthalene-2-carboxylate (PubChem CID 101399905) has the molecular formula C88H66O12 and a molecular weight of 1315.48 g/mol. Its IUPAC name is [3,5-bis[[3,5-bis[(4-benzoylphenyl)methoxy]phenyl]methoxy]phenyl]methyl naphthalene-2-carboxylate.
| Compound Name | [3,5-bis[[3,5-bis[(4-benzoylphenyl)methoxy]phenyl]methoxy]phenyl]methyl naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 101399905 |
| Molecular Formula | C88H66O12 |
| Molecular Weight | 1315.48 g/mol |
| Exact Mass | 1314.46 |
| IUPAC Name | [3,5-bis[[3,5-bis[(4-benzoylphenyl)methoxy]phenyl]methoxy]phenyl]methyl naphthalene-2-carboxylate |
| SMILES | O=C(OCc1cc(OCc2cc(OCc3ccc(C(=O)c4ccccc4)cc3)cc(OCc3ccc(C(=O)c4ccccc4)cc3)c2)cc(OCc2cc(OCc3ccc(C(=O)c4ccccc4)cc3)cc(OCc3ccc(C(=O)c4ccccc4)cc3)c2)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C88H66O12/c89-84(68-16-5-1-6-17-68)72-33-25-60(26-34-72)53-94-78-43-64(44-79(50-78)95-54-61-27-35-73(36-28-61)85(90)69-18-7-2-8-19-69)57-98-82-47-66(59-100-88(93)77-42-41-67-15-13-14-24-76(67)49-77)48-83(52-82)99-58-65-45-80(96-55-62-29-37-74(38-30-62)86(91)70-20-9-3-10-21-70)51-81(46-65)97-56-63-31-39-75(40-32-63)87(92)71-22-11-4-12-23-71/h1-52H,53-59H2 |
| InChIKey | BOZCQCAWBHSPHX-UHFFFAOYSA-N |
| XLogP | 18.59 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 100 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1315.48 |
| LogP ≤ 5 | 18.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |