C20H24O6 — CID 68504536
[3,5-bis(3-hydroxypropoxy)phenyl]methyl benzoate (PubChem CID 68504536) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is [3,5-bis(3-hydroxypropoxy)phenyl]methyl benzoate.
| Compound Name | [3,5-bis(3-hydroxypropoxy)phenyl]methyl benzoate |
|---|---|
| PubChem CID | 68504536 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [3,5-bis(3-hydroxypropoxy)phenyl]methyl benzoate |
| SMILES | O=C(OCc1cc(OCCCO)cc(OCCCO)c1)c1ccccc1 |
| InChI | InChI=1S/C20H24O6/c21-8-4-10-24-18-12-16(13-19(14-18)25-11-5-9-22)15-26-20(23)17-6-2-1-3-7-17/h1-3,6-7,12-14,21-22H,4-5,8-11,15H2 |
| InChIKey | DCYKXLHEEPOBME-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|