C18H14O7 — CID 71898738
methyl 2-[(1,4-dihydroxynaphthalene-2-carbonyl)oxymethyl]furan-3-carboxylate (PubChem CID 71898738) has the molecular formula C18H14O7 and a molecular weight of 342.30 g/mol. Its IUPAC name is methyl 2-[(1,4-dihydroxynaphthalene-2-carbonyl)oxymethyl]furan-3-carboxylate.
| Compound Name | methyl 2-[(1,4-dihydroxynaphthalene-2-carbonyl)oxymethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 71898738 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methyl 2-[(1,4-dihydroxynaphthalene-2-carbonyl)oxymethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1COC(=O)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C18H14O7/c1-23-17(21)12-6-7-24-15(12)9-25-18(22)13-8-14(19)10-4-2-3-5-11(10)16(13)20/h2-8,19-20H,9H2,1H3 |
| InChIKey | JOYYEAPZLIELCX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|