C15H11NO5 — CID 154771054
1,2-oxazol-5-ylmethyl 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 154771054) has the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. Its IUPAC name is 1,2-oxazol-5-ylmethyl 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | 1,2-oxazol-5-ylmethyl 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 154771054 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1,2-oxazol-5-ylmethyl 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCc1ccno1)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C15H11NO5/c17-13-7-12(14(18)11-4-2-1-3-10(11)13)15(19)20-8-9-5-6-16-21-9/h1-7,17-18H,8H2 |
| InChIKey | BUFMUPWXADJLRL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|