C19H15BrO5 — CID 3511092
2-(4-bromophenoxy)ethyl 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 3511092) has the molecular formula C19H15BrO5 and a molecular weight of 403.23 g/mol. Its IUPAC name is 2-(4-bromophenoxy)ethyl 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | 2-(4-bromophenoxy)ethyl 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 3511092 |
| Molecular Formula | C19H15BrO5 |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 2-(4-bromophenoxy)ethyl 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(OCCOc1ccc(Br)cc1)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C19H15BrO5/c20-12-5-7-13(8-6-12)24-9-10-25-19(23)16-11-17(21)14-3-1-2-4-15(14)18(16)22/h1-8,11,21-22H,9-10H2 |
| InChIKey | NDCDHRSSGVIYDE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|