C16H13BrO4 — CID 78906397
1-[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromophenyl]ethanone (PubChem CID 78906397) has the molecular formula C16H13BrO4 and a molecular weight of 349.18 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromophenyl]ethanone.
| Compound Name | 1-[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromophenyl]ethanone |
|---|---|
| PubChem CID | 78906397 |
| Molecular Formula | C16H13BrO4 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromophenyl]ethanone |
| SMILES | CC(=O)c1cc(Br)ccc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13BrO4/c1-10(18)13-7-12(17)3-5-14(13)19-8-11-2-4-15-16(6-11)21-9-20-15/h2-7H,8-9H2,1H3 |
| InChIKey | ICFPEKXMEVEKCP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |