C16H13BrO6S — CID 26949328
(2-acetyl-4-bromophenyl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate (PubChem CID 26949328) has the molecular formula C16H13BrO6S and a molecular weight of 413.25 g/mol. Its IUPAC name is (2-acetyl-4-bromophenyl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate.
| Compound Name | (2-acetyl-4-bromophenyl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate |
|---|---|
| PubChem CID | 26949328 |
| Molecular Formula | C16H13BrO6S |
| Molecular Weight | 413.25 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | (2-acetyl-4-bromophenyl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate |
| SMILES | CC(=O)c1cc(Br)ccc1OS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H13BrO6S/c1-10(18)13-8-11(17)2-4-14(13)23-24(19,20)12-3-5-15-16(9-12)22-7-6-21-15/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | OXTDHQLLPFZLDC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|