C16H16O6S — CID 26948912
(2-ethoxyphenyl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate (PubChem CID 26948912) has the molecular formula C16H16O6S and a molecular weight of 336.37 g/mol. Its IUPAC name is (2-ethoxyphenyl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate.
| Compound Name | (2-ethoxyphenyl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate |
|---|---|
| PubChem CID | 26948912 |
| Molecular Formula | C16H16O6S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (2-ethoxyphenyl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate |
| SMILES | CCOc1ccccc1OS(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H16O6S/c1-2-19-13-5-3-4-6-15(13)22-23(17,18)12-7-8-14-16(11-12)21-10-9-20-14/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | UOGOENFQRCOOIN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|