C17H17NO7S — CID 7488627
(2-amino-2-oxoethyl) 3-(2-ethoxyphenoxy)sulfonylbenzoate (PubChem CID 7488627) has the molecular formula C17H17NO7S and a molecular weight of 379.39 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-(2-ethoxyphenoxy)sulfonylbenzoate.
| Compound Name | (2-amino-2-oxoethyl) 3-(2-ethoxyphenoxy)sulfonylbenzoate |
|---|---|
| PubChem CID | 7488627 |
| Molecular Formula | C17H17NO7S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-(2-ethoxyphenoxy)sulfonylbenzoate |
| SMILES | CCOc1ccccc1OS(=O)(=O)c1cccc(C(=O)OCC(N)=O)c1 |
| InChI | InChI=1S/C17H17NO7S/c1-2-23-14-8-3-4-9-15(14)25-26(21,22)13-7-5-6-12(10-13)17(20)24-11-16(18)19/h3-10H,2,11H2,1H3,(H2,18,19) |
| InChIKey | IMRXTWYOMHYQIG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|