C21H24N2O6S — CID 4851561
(2-ethoxyphenyl) 3-(4-acetylpiperazine-1-carbonyl)benzenesulfonate (PubChem CID 4851561) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is (2-ethoxyphenyl) 3-(4-acetylpiperazine-1-carbonyl)benzenesulfonate.
| Compound Name | (2-ethoxyphenyl) 3-(4-acetylpiperazine-1-carbonyl)benzenesulfonate |
|---|---|
| PubChem CID | 4851561 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (2-ethoxyphenyl) 3-(4-acetylpiperazine-1-carbonyl)benzenesulfonate |
| SMILES | CCOc1ccccc1OS(=O)(=O)c1cccc(C(=O)N2CCN(C(C)=O)CC2)c1 |
| InChI | InChI=1S/C21H24N2O6S/c1-3-28-19-9-4-5-10-20(19)29-30(26,27)18-8-6-7-17(15-18)21(25)23-13-11-22(12-14-23)16(2)24/h4-10,15H,3,11-14H2,1-2H3 |
| InChIKey | NCXCEGDKQVGLKH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|