C24H31NO6S — CID 90589363
[4-(benzenesulfonyl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone (PubChem CID 90589363) has the molecular formula C24H31NO6S and a molecular weight of 461.58 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone.
| Compound Name | [4-(benzenesulfonyl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
|---|---|
| PubChem CID | 90589363 |
| Molecular Formula | C24H31NO6S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | [4-(benzenesulfonyl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCC(S(=O)(=O)c3ccccc3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H31NO6S/c1-4-29-21-16-18(17-22(30-5-2)23(21)31-6-3)24(26)25-14-12-20(13-15-25)32(27,28)19-10-8-7-9-11-19/h7-11,16-17,20H,4-6,12-15H2,1-3H3 |
| InChIKey | VBNDLCAMFGCIHK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |