C20H28N4O4 — CID 121151312
[4-(triazol-1-yl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone (PubChem CID 121151312) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is [4-(triazol-1-yl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone.
| Compound Name | [4-(triazol-1-yl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
|---|---|
| PubChem CID | 121151312 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | [4-(triazol-1-yl)piperidin-1-yl]-(3,4,5-triethoxyphenyl)methanone |
| SMILES | CCOc1cc(C(=O)N2CCC(n3ccnn3)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H28N4O4/c1-4-26-17-13-15(14-18(27-5-2)19(17)28-6-3)20(25)23-10-7-16(8-11-23)24-12-9-21-22-24/h9,12-14,16H,4-8,10-11H2,1-3H3 |
| InChIKey | DIZVXCDMNAWZLH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |