C20H27F3N2O5 — CID 108548679
2,2,2-trifluoro-N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]acetamide (PubChem CID 108548679) has the molecular formula C20H27F3N2O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108548679 |
| Molecular Formula | C20H27F3N2O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-(3,4,5-triethoxybenzoyl)piperidin-4-yl]acetamide |
| SMILES | CCOc1cc(C(=O)N2CCC(NC(=O)C(F)(F)F)CC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H27F3N2O5/c1-4-28-15-11-13(12-16(29-5-2)17(15)30-6-3)18(26)25-9-7-14(8-10-25)24-19(27)20(21,22)23/h11-12,14H,4-10H2,1-3H3,(H,24,27) |
| InChIKey | ARNSGHAMNXHRTC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |