About 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate
1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate (PubChem CID 78868758) has the molecular formula C18H15N3O4
and a molecular weight of 337.34 g/mol. Its IUPAC name is 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate |
| PubChem CID | 78868758 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate |
| SMILES | CC(OC(=O)c1ccn(-c2cccc([N+](=O)[O-])c2)n1)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O4/c1-13(14-6-3-2-4-7-14)25-18(22)17-10-11-20(19-17)15-8-5-9-16(12-15)21(23)24/h2-13H,1H3 |
| InChIKey | WGIDESAFYHWIKW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate?
The IUPAC name of 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate (CID 78868758) is 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate.
What is the SMILES notation for 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate?
The canonical SMILES for 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate is CC(OC(=O)c1ccn(-c2cccc([N+](=O)[O-])c2)n1)c1ccccc1.
What is the InChIKey of 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate?
The InChIKey is WGIDESAFYHWIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O4/c1-13(14-6-3-2-4-7-14)25-18(22)17-10-11-20(19-17)15-8-5-9-16(12-15)21(23)24/h2-13H,1H3.
What are the key properties of 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate?
1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate has a molecular weight of 337.34 g/mol, XLogP of 3.70, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl 1-(3-nitrophenyl)pyrazole-3-carboxylate is sourced from PubChem (CID 78868758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).