C13H17ClN2S — CID 106122135
N-(1,3-benzothiazol-2-ylmethyl)-4-chloropentan-1-amine (PubChem CID 106122135) has the molecular formula C13H17ClN2S and a molecular weight of 268.81 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-4-chloropentan-1-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-4-chloropentan-1-amine |
|---|---|
| PubChem CID | 106122135 |
| Molecular Formula | C13H17ClN2S |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-4-chloropentan-1-amine |
| SMILES | CC(Cl)CCCNCc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H17ClN2S/c1-10(14)5-4-8-15-9-13-16-11-6-2-3-7-12(11)17-13/h2-3,6-7,10,15H,4-5,8-9H2,1H3 |
| InChIKey | APKPIAQKIZFCCB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|