C20H21N5OS — CID 38900912
N-[3-(1,3-benzothiazol-2-yl)propyl]-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 38900912) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 38900912 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCc2nc3ccccc3s2)c2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C20H21N5OS/c1-12-11-14(18-13(2)24-25(3)19(18)22-12)20(26)21-10-6-9-17-23-15-7-4-5-8-16(15)27-17/h4-5,7-8,11H,6,9-10H2,1-3H3,(H,21,26) |
| InChIKey | BLCLDFJRORHEEZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|